C22H26ClNO4 — CID 68999256
methyl 4-[2-[[4-(4-chlorophenoxy)phenoxy]methyl]pyrrolidin-1-yl]butanoate (PubChem CID 68999256) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is methyl 4-[2-[[4-(4-chlorophenoxy)phenoxy]methyl]pyrrolidin-1-yl]butanoate.
| Compound Name | methyl 4-[2-[[4-(4-chlorophenoxy)phenoxy]methyl]pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 68999256 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | methyl 4-[2-[[4-(4-chlorophenoxy)phenoxy]methyl]pyrrolidin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1CCCC1COc1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H26ClNO4/c1-26-22(25)5-3-15-24-14-2-4-18(24)16-27-19-10-12-21(13-11-19)28-20-8-6-17(23)7-9-20/h6-13,18H,2-5,14-16H2,1H3 |
| InChIKey | GHMOCJYRMBLHLZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |