C24H30ClNO3 — CID 68999316
methyl 4-[(2R)-2-[[4-[(4-chlorophenyl)methyl]phenoxy]methyl]piperidin-1-yl]butanoate (PubChem CID 68999316) has the molecular formula C24H30ClNO3 and a molecular weight of 415.96 g/mol. Its IUPAC name is methyl 4-[(2R)-2-[[4-[(4-chlorophenyl)methyl]phenoxy]methyl]piperidin-1-yl]butanoate.
| Compound Name | methyl 4-[(2R)-2-[[4-[(4-chlorophenyl)methyl]phenoxy]methyl]piperidin-1-yl]butanoate |
|---|---|
| PubChem CID | 68999316 |
| Molecular Formula | C24H30ClNO3 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | methyl 4-[(2R)-2-[[4-[(4-chlorophenyl)methyl]phenoxy]methyl]piperidin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1CCCC[C@@H]1COc1ccc(Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H30ClNO3/c1-28-24(27)6-4-16-26-15-3-2-5-22(26)18-29-23-13-9-20(10-14-23)17-19-7-11-21(25)12-8-19/h7-14,22H,2-6,15-18H2,1H3/t22-/m1/s1 |
| InChIKey | HWYKDCIMKDHUGC-JOCHJYFZSA-N |
| XLogP | 5.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |