C10H14F3N3O — CID 151933544
N-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)pyrazol-4-amine (PubChem CID 151933544) has the molecular formula C10H14F3N3O and a molecular weight of 249.24 g/mol. Its IUPAC name is N-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)pyrazol-4-amine.
| Compound Name | N-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 151933544 |
| Molecular Formula | C10H14F3N3O |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-(oxan-4-yl)-1-(2,2,2-trifluoroethyl)pyrazol-4-amine |
| SMILES | FC(F)(F)Cn1cc(NC2CCOCC2)cn1 |
| InChI | InChI=1S/C10H14F3N3O/c11-10(12,13)7-16-6-9(5-14-16)15-8-1-3-17-4-2-8/h5-6,8,15H,1-4,7H2 |
| InChIKey | SZHOUBKESQXDBY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |