C12H16F3N3O2 — CID 71810259
4,4,4-trifluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]butanamide (PubChem CID 71810259) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]butanamide |
|---|---|
| PubChem CID | 71810259 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4,4,4-trifluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]butanamide |
| SMILES | O=C(CCC(F)(F)F)Nc1cnn(C2CCOCC2)c1 |
| InChI | InChI=1S/C12H16F3N3O2/c13-12(14,15)4-1-11(19)17-9-7-16-18(8-9)10-2-5-20-6-3-10/h7-8,10H,1-6H2,(H,17,19) |
| InChIKey | OUESGVCKZFHGFZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |