C13H12N2O — CID 15194305
3-ethyl-1-methylindeno[2,1-d]pyrazol-4-one (PubChem CID 15194305) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-ethyl-1-methylindeno[2,1-d]pyrazol-4-one.
| Compound Name | 3-ethyl-1-methylindeno[2,1-d]pyrazol-4-one |
|---|---|
| PubChem CID | 15194305 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 3-ethyl-1-methylindeno[2,1-d]pyrazol-4-one |
| SMILES | CCc1nn(C)c2c1C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C13H12N2O/c1-3-10-11-12(15(2)14-10)8-6-4-5-7-9(8)13(11)16/h4-7H,3H2,1-2H3 |
| InChIKey | FKRPWENEWWIWGO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |