C20H18N2O — CID 12847969
1-tert-butyl-3-phenylindeno[2,1-d]pyrazol-4-one (PubChem CID 12847969) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-tert-butyl-3-phenylindeno[2,1-d]pyrazol-4-one.
| Compound Name | 1-tert-butyl-3-phenylindeno[2,1-d]pyrazol-4-one |
|---|---|
| PubChem CID | 12847969 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-tert-butyl-3-phenylindeno[2,1-d]pyrazol-4-one |
| SMILES | CC(C)(C)n1nc(-c2ccccc2)c2c1-c1ccccc1C2=O |
| InChI | InChI=1S/C20H18N2O/c1-20(2,3)22-18-14-11-7-8-12-15(14)19(23)16(18)17(21-22)13-9-5-4-6-10-13/h4-12H,1-3H3 |
| InChIKey | HJNPQSUTZIVZDQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |