About 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one
1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one (PubChem CID 139237479) has the molecular formula C23H12FN3OS
and a molecular weight of 397.43 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one.
Molecular Properties
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one |
| PubChem CID | 139237479 |
| Molecular Formula | C23H12FN3OS |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one |
| SMILES | O=C1c2ccccc2-c2c1c(-c1ccc(F)cc1)nn2-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H12FN3OS/c24-14-11-9-13(10-12-14)20-19-21(15-5-1-2-6-16(15)22(19)28)27(26-20)23-25-17-7-3-4-8-18(17)29-23/h1-12H |
| InChIKey | QKAWUZWHRAMJOP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one?
The IUPAC name of 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one (CID 139237479) is 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one.
What is the SMILES notation for 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one?
The canonical SMILES for 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one is O=C1c2ccccc2-c2c1c(-c1ccc(F)cc1)nn2-c1nc2ccccc2s1.
What is the InChIKey of 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one?
The InChIKey is QKAWUZWHRAMJOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H12FN3OS/c24-14-11-9-13(10-12-14)20-19-21(15-5-1-2-6-16(15)22(19)28)27(26-20)23-25-17-7-3-4-8-18(17)29-23/h1-12H.
What are the key properties of 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one?
1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one has a molecular weight of 397.43 g/mol, XLogP of 5.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzothiazol-2-yl)-3-(4-fluorophenyl)indeno[2,1-d]pyrazol-4-one is sourced from PubChem (CID 139237479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).