C19H18N6O6S — CID 151947786
(2S)-2-[[4-[(4-oxo-2-sulfanylidene-1H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid (PubChem CID 151947786) has the molecular formula C19H18N6O6S and a molecular weight of 458.46 g/mol. Its IUPAC name is (2S)-2-[[4-[(4-oxo-2-sulfanylidene-1H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[(4-oxo-2-sulfanylidene-1H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 151947786 |
| Molecular Formula | C19H18N6O6S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | (2S)-2-[[4-[(4-oxo-2-sulfanylidene-1H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1ccc(NCc2cnc3[nH]c(=S)[nH]c(=O)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C19H18N6O6S/c26-13(27)6-5-12(18(30)31)23-16(28)9-1-3-10(4-2-9)20-7-11-8-21-15-14(22-11)17(29)25-19(32)24-15/h1-4,8,12,20H,5-7H2,(H,23,28)(H,26,27)(H,30,31)(H2,21,24,25,29,32)/t12-/m0/s1 |
| InChIKey | TVZSIECMQWNNKO-LBPRGKRZSA-N |
| XLogP | 1.04 |
| TPSA | 190.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|