C21H23N9O6 — CID 167702999
(2S)-2-[[4-[[2-(dimethylaminodiazenyl)-4-oxo-3H-pteridin-6-yl]methylamino]benzoyl]amino]pentanedioic acid (PubChem CID 167702999) has the molecular formula C21H23N9O6 and a molecular weight of 497.47 g/mol. Its IUPAC name is (2S)-2-[[4-[[2-(dimethylaminodiazenyl)-4-oxo-3H-pteridin-6-yl]methylamino]benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[[2-(dimethylaminodiazenyl)-4-oxo-3H-pteridin-6-yl]methylamino]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 167702999 |
| Molecular Formula | C21H23N9O6 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (2S)-2-[[4-[[2-(dimethylaminodiazenyl)-4-oxo-3H-pteridin-6-yl]methylamino]benzoyl]amino]pentanedioic acid |
| SMILES | CN(C)N=Nc1nc2ncc(CNc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H23N9O6/c1-30(2)29-28-21-26-17-16(19(34)27-21)24-13(10-23-17)9-22-12-5-3-11(4-6-12)18(33)25-14(20(35)36)7-8-15(31)32/h3-6,10,14,22H,7-9H2,1-2H3,(H,25,33)(H,31,32)(H,35,36)(H,23,26,27,34)/t14-/m0/s1 |
| InChIKey | JNRKKTIJRRWPOY-AWEZNQCLSA-N |
| XLogP | 0.93 |
| TPSA | 215.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|