C22H26O6S2 — CID 15195802
[(1R,2S,4R,6R)-6-(4-methylphenyl)sulfonyloxy-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate (PubChem CID 15195802) has the molecular formula C22H26O6S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is [(1R,2S,4R,6R)-6-(4-methylphenyl)sulfonyloxy-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S,4R,6R)-6-(4-methylphenyl)sulfonyloxy-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15195802 |
| Molecular Formula | C22H26O6S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [(1R,2S,4R,6R)-6-(4-methylphenyl)sulfonyloxy-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2C[C@@H]3C[C@H]2[C@H](OS(=O)(=O)c2ccc(C)cc2)C3)cc1 |
| InChI | InChI=1S/C22H26O6S2/c1-15-3-7-19(8-4-15)29(23,24)27-14-18-11-17-12-21(18)22(13-17)28-30(25,26)20-9-5-16(2)6-10-20/h3-10,17-18,21-22H,11-14H2,1-2H3/t17-,18-,21-,22-/m1/s1 |
| InChIKey | LZNCDALZPSZJOB-MCEIDBOGSA-N |
| XLogP | 3.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|