C12H14BrF3N2O — CID 151965423
4-bromo-3,5-diethyl-2-(trifluoromethoxy)benzenecarboximidamide (PubChem CID 151965423) has the molecular formula C12H14BrF3N2O and a molecular weight of 339.16 g/mol. Its IUPAC name is 4-bromo-3,5-diethyl-2-(trifluoromethoxy)benzenecarboximidamide.
| Compound Name | 4-bromo-3,5-diethyl-2-(trifluoromethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 151965423 |
| Molecular Formula | C12H14BrF3N2O |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 4-bromo-3,5-diethyl-2-(trifluoromethoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(CC)c(Br)c(CC)c1OC(F)(F)F |
| InChI | InChI=1S/C12H14BrF3N2O/c1-3-6-5-8(11(17)18)10(19-12(14,15)16)7(4-2)9(6)13/h5H,3-4H2,1-2H3,(H3,17,18) |
| InChIKey | TZOBBTXNNQOGME-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|