C21H16ClFN2O3S — CID 151966668
2-chloro-4-fluoro-5-[[6-methoxy-7-(thiophen-3-ylmethoxy)quinazolin-4-yl]methyl]phenol (PubChem CID 151966668) has the molecular formula C21H16ClFN2O3S and a molecular weight of 430.89 g/mol. Its IUPAC name is 2-chloro-4-fluoro-5-[[6-methoxy-7-(thiophen-3-ylmethoxy)quinazolin-4-yl]methyl]phenol.
| Compound Name | 2-chloro-4-fluoro-5-[[6-methoxy-7-(thiophen-3-ylmethoxy)quinazolin-4-yl]methyl]phenol |
|---|---|
| PubChem CID | 151966668 |
| Molecular Formula | C21H16ClFN2O3S |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-chloro-4-fluoro-5-[[6-methoxy-7-(thiophen-3-ylmethoxy)quinazolin-4-yl]methyl]phenol |
| SMILES | COc1cc2c(Cc3cc(O)c(Cl)cc3F)ncnc2cc1OCc1ccsc1 |
| InChI | InChI=1S/C21H16ClFN2O3S/c1-27-20-6-14-17(4-13-5-19(26)15(22)7-16(13)23)24-11-25-18(14)8-21(20)28-9-12-2-3-29-10-12/h2-3,5-8,10-11,26H,4,9H2,1H3 |
| InChIKey | TZURBPRHLLNYBW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |