C22H19N3O2 — CID 176664908
6,7-dimethoxy-4-[(3-pyridin-4-ylphenyl)methyl]quinazoline (PubChem CID 176664908) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 6,7-dimethoxy-4-[(3-pyridin-4-ylphenyl)methyl]quinazoline.
| Compound Name | 6,7-dimethoxy-4-[(3-pyridin-4-ylphenyl)methyl]quinazoline |
|---|---|
| PubChem CID | 176664908 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 6,7-dimethoxy-4-[(3-pyridin-4-ylphenyl)methyl]quinazoline |
| SMILES | COc1cc2ncnc(Cc3cccc(-c4ccncc4)c3)c2cc1OC |
| InChI | InChI=1S/C22H19N3O2/c1-26-21-12-18-19(24-14-25-20(18)13-22(21)27-2)11-15-4-3-5-17(10-15)16-6-8-23-9-7-16/h3-10,12-14H,11H2,1-2H3 |
| InChIKey | OAQLHLLNGHVEQH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |