C20H22N4O2 — CID 176664922
4-[(1,2-dimethyl-3H-indazol-6-yl)methyl]-6,7-dimethoxyquinazoline (PubChem CID 176664922) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[(1,2-dimethyl-3H-indazol-6-yl)methyl]-6,7-dimethoxyquinazoline.
| Compound Name | 4-[(1,2-dimethyl-3H-indazol-6-yl)methyl]-6,7-dimethoxyquinazoline |
|---|---|
| PubChem CID | 176664922 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-[(1,2-dimethyl-3H-indazol-6-yl)methyl]-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2ncnc(Cc3ccc4c(c3)N(C)N(C)C4)c2cc1OC |
| InChI | InChI=1S/C20H22N4O2/c1-23-11-14-6-5-13(8-18(14)24(23)2)7-16-15-9-19(25-3)20(26-4)10-17(15)22-12-21-16/h5-6,8-10,12H,7,11H2,1-4H3 |
| InChIKey | JCHLODVHJRPBCM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |