C18H16ClN3O2 — CID 18932856
4-(5-chloro-2,3-dihydroindol-1-yl)-6,7-dimethoxyquinazoline (PubChem CID 18932856) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is 4-(5-chloro-2,3-dihydroindol-1-yl)-6,7-dimethoxyquinazoline.
| Compound Name | 4-(5-chloro-2,3-dihydroindol-1-yl)-6,7-dimethoxyquinazoline |
|---|---|
| PubChem CID | 18932856 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 4-(5-chloro-2,3-dihydroindol-1-yl)-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2ncnc(N3CCc4cc(Cl)ccc43)c2cc1OC |
| InChI | InChI=1S/C18H16ClN3O2/c1-23-16-8-13-14(9-17(16)24-2)20-10-21-18(13)22-6-5-11-7-12(19)3-4-15(11)22/h3-4,7-10H,5-6H2,1-2H3 |
| InChIKey | FZODPGDYKJRDLB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |