C20H23N3O6S — CID 86752367
6,7-dimethoxy-4-(5-methoxy-2,3-dihydroindol-1-yl)quinazoline;methanesulfonic acid (PubChem CID 86752367) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is 6,7-dimethoxy-4-(5-methoxy-2,3-dihydroindol-1-yl)quinazoline;methanesulfonic acid.
| Compound Name | 6,7-dimethoxy-4-(5-methoxy-2,3-dihydroindol-1-yl)quinazoline;methanesulfonic acid |
|---|---|
| PubChem CID | 86752367 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 6,7-dimethoxy-4-(5-methoxy-2,3-dihydroindol-1-yl)quinazoline;methanesulfonic acid |
| SMILES | COc1ccc2c(c1)CCN2c1ncnc2cc(OC)c(OC)cc12.CS(=O)(=O)O |
| InChI | InChI=1S/C19H19N3O3.CH4O3S/c1-23-13-4-5-16-12(8-13)6-7-22(16)19-14-9-17(24-2)18(25-3)10-15(14)20-11-21-19;1-5(2,3)4/h4-5,8-11H,6-7H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | ASJVDTMCTSFLJM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|