C18H18N4O2 — CID 54313644
1-(6,7-dimethoxyquinazolin-4-yl)-2,3-dihydroindol-6-amine (PubChem CID 54313644) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-(6,7-dimethoxyquinazolin-4-yl)-2,3-dihydroindol-6-amine.
| Compound Name | 1-(6,7-dimethoxyquinazolin-4-yl)-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 54313644 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-(6,7-dimethoxyquinazolin-4-yl)-2,3-dihydroindol-6-amine |
| SMILES | COc1cc2ncnc(N3CCc4ccc(N)cc43)c2cc1OC |
| InChI | InChI=1S/C18H18N4O2/c1-23-16-8-13-14(9-17(16)24-2)20-10-21-18(13)22-6-5-11-3-4-12(19)7-15(11)22/h3-4,7-10H,5-6,19H2,1-2H3 |
| InChIKey | SMPZDXOYPKEJKL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|