C12H25NO2Si — CID 151967650
dimethoxy-(1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinolin-1-yl)silane (PubChem CID 151967650) has the molecular formula C12H25NO2Si and a molecular weight of 243.42 g/mol. Its IUPAC name is dimethoxy-(1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinolin-1-yl)silane.
| Compound Name | dimethoxy-(1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinolin-1-yl)silane |
|---|---|
| PubChem CID | 151967650 |
| Molecular Formula | C12H25NO2Si |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | dimethoxy-(1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-isoquinolin-1-yl)silane |
| SMILES | CO[SiH](OC)C1(C)NCCC2CCCCC21 |
| InChI | InChI=1S/C12H25NO2Si/c1-12(16(14-2)15-3)11-7-5-4-6-10(11)8-9-13-12/h10-11,13,16H,4-9H2,1-3H3 |
| InChIKey | TZZQWKSZXMHEFD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|