C17H22O6S — CID 15197452
ethyl (3S,4R)-5,5-dimethyl-4-[(4-methylphenyl)sulfonylmethyl]-2-oxooxolane-3-carboxylate (PubChem CID 15197452) has the molecular formula C17H22O6S and a molecular weight of 354.42 g/mol. Its IUPAC name is ethyl (3S,4R)-5,5-dimethyl-4-[(4-methylphenyl)sulfonylmethyl]-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl (3S,4R)-5,5-dimethyl-4-[(4-methylphenyl)sulfonylmethyl]-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 15197452 |
| Molecular Formula | C17H22O6S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | ethyl (3S,4R)-5,5-dimethyl-4-[(4-methylphenyl)sulfonylmethyl]-2-oxooxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)OC(C)(C)[C@@H]1CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H22O6S/c1-5-22-15(18)14-13(17(3,4)23-16(14)19)10-24(20,21)12-8-6-11(2)7-9-12/h6-9,13-14H,5,10H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | OGSPWDJTBSPJFQ-KGLIPLIRSA-N |
| XLogP | 1.90 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|