C15H16F4O4S — CID 139700296
5-ethyl-3-fluoro-4-[(4-methylphenyl)sulfonylmethyl]-3-(trifluoromethyl)oxolan-2-one (PubChem CID 139700296) has the molecular formula C15H16F4O4S and a molecular weight of 368.35 g/mol. Its IUPAC name is 5-ethyl-3-fluoro-4-[(4-methylphenyl)sulfonylmethyl]-3-(trifluoromethyl)oxolan-2-one.
| Compound Name | 5-ethyl-3-fluoro-4-[(4-methylphenyl)sulfonylmethyl]-3-(trifluoromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 139700296 |
| Molecular Formula | C15H16F4O4S |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 5-ethyl-3-fluoro-4-[(4-methylphenyl)sulfonylmethyl]-3-(trifluoromethyl)oxolan-2-one |
| SMILES | CCC1OC(=O)C(F)(C(F)(F)F)C1CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H16F4O4S/c1-3-12-11(14(16,13(20)23-12)15(17,18)19)8-24(21,22)10-6-4-9(2)5-7-10/h4-7,11-12H,3,8H2,1-2H3 |
| InChIKey | MGRPZQLKDABNPS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |