C21H17N3O9S — CID 151975080
1,3-bis(2-nitrophenyl)propan-2-yl 2-nitrobenzenesulfonate (PubChem CID 151975080) has the molecular formula C21H17N3O9S and a molecular weight of 487.45 g/mol. Its IUPAC name is 1,3-bis(2-nitrophenyl)propan-2-yl 2-nitrobenzenesulfonate.
| Compound Name | 1,3-bis(2-nitrophenyl)propan-2-yl 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 151975080 |
| Molecular Formula | C21H17N3O9S |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 1,3-bis(2-nitrophenyl)propan-2-yl 2-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccccc1CC(Cc1ccccc1[N+](=O)[O-])OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N3O9S/c25-22(26)18-9-3-1-7-15(18)13-17(14-16-8-2-4-10-19(16)23(27)28)33-34(31,32)21-12-6-5-11-20(21)24(29)30/h1-12,17H,13-14H2 |
| InChIKey | UBMKWLVLCCIUET-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 172.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|