C23H18ClN5O2 — CID 151986572
6-chloro-N-[3-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-1H-indol-7-yl]pyridine-3-carboxamide (PubChem CID 151986572) has the molecular formula C23H18ClN5O2 and a molecular weight of 431.88 g/mol. Its IUPAC name is 6-chloro-N-[3-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-1H-indol-7-yl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[3-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-1H-indol-7-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 151986572 |
| Molecular Formula | C23H18ClN5O2 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 6-chloro-N-[3-[2-(cyclopropanecarbonylamino)-4-pyridinyl]-1H-indol-7-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc2c(-c3ccnc(NC(=O)C4CC4)c3)c[nH]c12)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C23H18ClN5O2/c24-19-7-6-15(11-26-19)23(31)28-18-3-1-2-16-17(12-27-21(16)18)14-8-9-25-20(10-14)29-22(30)13-4-5-13/h1-3,6-13,27H,4-5H2,(H,28,31)(H,25,29,30) |
| InChIKey | UDTZAMIDJWALSC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|