C11H15N3O2 — CID 15203502
4-propyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 15203502) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-propyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | 4-propyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 15203502 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-propyl-2,4,6-triazatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | CCCn1c(=O)n2n(c1=O)C1C=CC2CC1 |
| InChI | InChI=1S/C11H15N3O2/c1-2-7-12-10(15)13-8-3-4-9(6-5-8)14(13)11(12)16/h3-4,8-9H,2,5-7H2,1H3 |
| InChIKey | RPJBFTPRKWANDV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|