C13H14O2S — CID 15204457
8,9,10-trimethylidene-4lambda6-thiatricyclo[5.2.2.02,6]undec-2(6)-ene 4,4-dioxide (PubChem CID 15204457) has the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is 8,9,10-trimethylidene-4lambda6-thiatricyclo[5.2.2.02,6]undec-2(6)-ene 4,4-dioxide.
| Compound Name | 8,9,10-trimethylidene-4lambda6-thiatricyclo[5.2.2.02,6]undec-2(6)-ene 4,4-dioxide |
|---|---|
| PubChem CID | 15204457 |
| Molecular Formula | C13H14O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 8,9,10-trimethylidene-4lambda6-thiatricyclo[5.2.2.02,6]undec-2(6)-ene 4,4-dioxide |
| SMILES | C=C1C(=C)C2C(=C)CC1C1=C2CS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14O2S/c1-7-4-10-8(2)9(3)13(7)12-6-16(14,15)5-11(10)12/h10,13H,1-6H2 |
| InChIKey | MYHGLIJKHNYHGY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|