C12H18O2S — CID 94034907
(3aS,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydrobenzo[g][2]benzothiole 2,2-dioxide (PubChem CID 94034907) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is (3aS,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydrobenzo[g][2]benzothiole 2,2-dioxide.
| Compound Name | (3aS,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydrobenzo[g][2]benzothiole 2,2-dioxide |
|---|---|
| PubChem CID | 94034907 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (3aS,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydrobenzo[g][2]benzothiole 2,2-dioxide |
| SMILES | O=S1(=O)C[C@H]2CC=C3CCCC[C@H]3[C@@H]2C1 |
| InChI | InChI=1S/C12H18O2S/c13-15(14)7-10-6-5-9-3-1-2-4-11(9)12(10)8-15/h5,10-12H,1-4,6-8H2/t10-,11-,12-/m1/s1 |
| InChIKey | IDUKJPBRTFHNFG-IJLUTSLNSA-N |
| XLogP | 2.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|