C12H16O2S — CID 134934440
3a,4,5,6,7,8,9,9a-octahydrobenzo[f][1]benzothiole 1,1-dioxide (PubChem CID 134934440) has the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. Its IUPAC name is 3a,4,5,6,7,8,9,9a-octahydrobenzo[f][1]benzothiole 1,1-dioxide.
| Compound Name | 3a,4,5,6,7,8,9,9a-octahydrobenzo[f][1]benzothiole 1,1-dioxide |
|---|---|
| PubChem CID | 134934440 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 3a,4,5,6,7,8,9,9a-octahydrobenzo[f][1]benzothiole 1,1-dioxide |
| SMILES | O=S1(=O)C=CC2CC3=C(CCCC3)CC21 |
| InChI | InChI=1S/C12H16O2S/c13-15(14)6-5-11-7-9-3-1-2-4-10(9)8-12(11)15/h5-6,11-12H,1-4,7-8H2 |
| InChIKey | MACDVTCRAYPUCM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|