C13H18O2S — CID 10037221
10,10-dimethyl-2λ6-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene 2,2-dioxide (PubChem CID 10037221) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 10,10-dimethyl-2λ6-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene 2,2-dioxide.
| Compound Name | 10,10-dimethyl-2λ6-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene 2,2-dioxide |
|---|---|
| PubChem CID | 10037221 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 10,10-dimethyl-2λ6-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene 2,2-dioxide |
| SMILES | CC1(C)CC2=CCCC3=CS(=O)(=O)C(C1)C32 |
| InChI | InChI=1S/C13H18O2S/c1-13(2)6-9-4-3-5-10-8-16(14,15)11(7-13)12(9)10/h4,8,11-12H,3,5-7H2,1-2H3 |
| InChIKey | FIUGERVCLHFRRV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|