C18H22O2S — CID 11558526
9-(cyclohexen-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2,2-dioxide (PubChem CID 11558526) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is 9-(cyclohexen-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2,2-dioxide.
| Compound Name | 9-(cyclohexen-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2,2-dioxide |
|---|---|
| PubChem CID | 11558526 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 9-(cyclohexen-1-yl)-5,6,7,8,8a,9-hexahydrobenzo[f][2]benzothiole 2,2-dioxide |
| SMILES | O=S1(=O)C=C2C=C3CCCCC3C(C3=CCCCC3)C2=C1 |
| InChI | InChI=1S/C18H22O2S/c19-21(20)11-15-10-14-8-4-5-9-16(14)18(17(15)12-21)13-6-2-1-3-7-13/h6,10-12,16,18H,1-5,7-9H2 |
| InChIKey | WXSJAFIEEWLVLT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|