C14H13N3 — CID 15208316
N,N-dimethyl-1,10-phenanthrolin-5-amine (PubChem CID 15208316) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is N,N-dimethyl-1,10-phenanthrolin-5-amine.
| Compound Name | N,N-dimethyl-1,10-phenanthrolin-5-amine |
|---|---|
| PubChem CID | 15208316 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N,N-dimethyl-1,10-phenanthrolin-5-amine |
| SMILES | CN(C)c1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C14H13N3/c1-17(2)12-9-10-5-3-7-15-13(10)14-11(12)6-4-8-16-14/h3-9H,1-2H3 |
| InChIKey | CZUNWFJPQBEKEH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|