About 1-butoxy-N,N-bis(butoxymethyl)methanamine
1-butoxy-N,N-bis(butoxymethyl)methanamine (PubChem CID 15209158) has the molecular formula C15H33NO3
and a molecular weight of 275.43 g/mol. Its IUPAC name is 1-butoxy-N,N-bis(butoxymethyl)methanamine.
Molecular Properties
| Compound Name | 1-butoxy-N,N-bis(butoxymethyl)methanamine |
| PubChem CID | 15209158 |
| Molecular Formula | C15H33NO3 |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | 1-butoxy-N,N-bis(butoxymethyl)methanamine |
| SMILES | CCCCOCN(COCCCC)COCCCC |
| InChI | InChI=1S/C15H33NO3/c1-4-7-10-17-13-16(14-18-11-8-5-2)15-19-12-9-6-3/h4-15H2,1-3H3 |
| InChIKey | KGIBFRBYYCIFSN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxy-N,N-bis(butoxymethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxy-N,N-bis(butoxymethyl)methanamine?
The IUPAC name of 1-butoxy-N,N-bis(butoxymethyl)methanamine (CID 15209158) is 1-butoxy-N,N-bis(butoxymethyl)methanamine.
What is the SMILES notation for 1-butoxy-N,N-bis(butoxymethyl)methanamine?
The canonical SMILES for 1-butoxy-N,N-bis(butoxymethyl)methanamine is CCCCOCN(COCCCC)COCCCC.
What is the InChIKey of 1-butoxy-N,N-bis(butoxymethyl)methanamine?
The InChIKey is KGIBFRBYYCIFSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO3/c1-4-7-10-17-13-16(14-18-11-8-5-2)15-19-12-9-6-3/h4-15H2,1-3H3.
What are the key properties of 1-butoxy-N,N-bis(butoxymethyl)methanamine?
1-butoxy-N,N-bis(butoxymethyl)methanamine has a molecular weight of 275.43 g/mol, XLogP of 3.61, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxy-N,N-bis(butoxymethyl)methanamine is sourced from PubChem (CID 15209158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).