About 1-butoxy-N,N-dimethylmethanamine
1-butoxy-N,N-dimethylmethanamine (PubChem CID 12860076) has the molecular formula C7H17NO
and a molecular weight of 131.22 g/mol. Its IUPAC name is 1-butoxy-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-butoxy-N,N-dimethylmethanamine |
| PubChem CID | 12860076 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | 1-butoxy-N,N-dimethylmethanamine |
| SMILES | CCCCOCN(C)C |
| InChI | InChI=1S/C7H17NO/c1-4-5-6-9-7-8(2)3/h4-7H2,1-3H3 |
| InChIKey | HPUIQFXZXVKZBN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxy-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxy-N,N-dimethylmethanamine?
The IUPAC name of 1-butoxy-N,N-dimethylmethanamine (CID 12860076) is 1-butoxy-N,N-dimethylmethanamine.
What is the SMILES notation for 1-butoxy-N,N-dimethylmethanamine?
The canonical SMILES for 1-butoxy-N,N-dimethylmethanamine is CCCCOCN(C)C.
What is the InChIKey of 1-butoxy-N,N-dimethylmethanamine?
The InChIKey is HPUIQFXZXVKZBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO/c1-4-5-6-9-7-8(2)3/h4-7H2,1-3H3.
What are the key properties of 1-butoxy-N,N-dimethylmethanamine?
1-butoxy-N,N-dimethylmethanamine has a molecular weight of 131.22 g/mol, XLogP of 1.32, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxy-N,N-dimethylmethanamine is sourced from PubChem (CID 12860076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).