About 2-phenylsulfanylbenzoic acid
2-phenylsulfanylbenzoic acid (PubChem CID 15210) has the molecular formula C13H10O2S
and a molecular weight of 230.29 g/mol. Its IUPAC name is 2-phenylsulfanylbenzoic acid.
Molecular Properties
| Compound Name | 2-phenylsulfanylbenzoic acid |
| PubChem CID | 15210 |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-phenylsulfanylbenzoic acid |
| SMILES | O=C(O)c1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C13H10O2S/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15) |
| InChIKey | PMLBXJKQYSENQH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylsulfanylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylbenzoic acid?
The IUPAC name of 2-phenylsulfanylbenzoic acid (CID 15210) is 2-phenylsulfanylbenzoic acid.
What is the SMILES notation for 2-phenylsulfanylbenzoic acid?
The canonical SMILES for 2-phenylsulfanylbenzoic acid is O=C(O)c1ccccc1Sc1ccccc1.
What is the InChIKey of 2-phenylsulfanylbenzoic acid?
The InChIKey is PMLBXJKQYSENQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2S/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15).
What are the key properties of 2-phenylsulfanylbenzoic acid?
2-phenylsulfanylbenzoic acid has a molecular weight of 230.29 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylbenzoic acid is sourced from PubChem (CID 15210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).