C19H23NO5 — CID 15214893
[(1S,12S,14R)-9-hydroxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (3R)-3-hydroxybutanoate (PubChem CID 15214893) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is [(1S,12S,14R)-9-hydroxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (3R)-3-hydroxybutanoate.
| Compound Name | [(1S,12S,14R)-9-hydroxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (3R)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 15214893 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [(1S,12S,14R)-9-hydroxy-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-yl] (3R)-3-hydroxybutanoate |
| SMILES | C[C@@H](O)CC(=O)O[C@H]1C=C[C@@]23CCNCc4ccc(O)c(c42)O[C@H]3C1 |
| InChI | InChI=1S/C19H23NO5/c1-11(21)8-16(23)24-13-4-5-19-6-7-20-10-12-2-3-14(22)18(17(12)19)25-15(19)9-13/h2-5,11,13,15,20-22H,6-10H2,1H3/t11-,13+,15+,19+/m1/s1 |
| InChIKey | TYKZEEVHXFAXJZ-UTKHUVCWSA-N |
| XLogP | 1.53 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|