C14H18N2O4S3 — CID 15216028
ethyl 2-(ethoxycarbonylcarbamothioylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate (PubChem CID 15216028) has the molecular formula C14H18N2O4S3 and a molecular weight of 374.51 g/mol. Its IUPAC name is ethyl 2-(ethoxycarbonylcarbamothioylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate.
| Compound Name | ethyl 2-(ethoxycarbonylcarbamothioylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate |
|---|---|
| PubChem CID | 15216028 |
| Molecular Formula | C14H18N2O4S3 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | ethyl 2-(ethoxycarbonylcarbamothioylamino)-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate |
| SMILES | CCOC(=O)NC(=S)Nc1sc2c(c1C(=O)OCC)CCSC2 |
| InChI | InChI=1S/C14H18N2O4S3/c1-3-19-12(17)10-8-5-6-22-7-9(8)23-11(10)15-13(21)16-14(18)20-4-2/h3-7H2,1-2H3,(H2,15,16,18,21) |
| InChIKey | KKDDFFBXMZIEIV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|