C32H12O12Si — CID 15216346
5-[tris(1,3-dioxo-2-benzofuran-5-yl)silyl]-2-benzofuran-1,3-dione (PubChem CID 15216346) has the molecular formula C32H12O12Si and a molecular weight of 616.52 g/mol. Its IUPAC name is 5-[tris(1,3-dioxo-2-benzofuran-5-yl)silyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[tris(1,3-dioxo-2-benzofuran-5-yl)silyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 15216346 |
| Molecular Formula | C32H12O12Si |
| Molecular Weight | 616.52 g/mol |
| Exact Mass | 616.01 |
| IUPAC Name | 5-[tris(1,3-dioxo-2-benzofuran-5-yl)silyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc([Si](c3ccc4c(c3)C(=O)OC4=O)(c3ccc4c(c3)C(=O)OC4=O)c3ccc4c(c3)C(=O)OC4=O)ccc21 |
| InChI | InChI=1S/C32H12O12Si/c33-25-17-5-1-13(9-21(17)29(37)41-25)45(14-2-6-18-22(10-14)30(38)42-26(18)34,15-3-7-19-23(11-15)31(39)43-27(19)35)16-4-8-20-24(12-16)32(40)44-28(20)36/h1-12H |
| InChIKey | KUNFKVAUTHGPLU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.52 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|