C46H21F3O12 — CID 158816281
5-(1,3-dioxo-6-phenyl-2-benzofuran-5-yl)-6-phenyl-2-benzofuran-1,3-dione;5-[1,3-dioxo-6-(trifluoromethyl)-2-benzofuran-5-yl]-6-methyl-2-benzofuran-1,3-dione (PubChem CID 158816281) has the molecular formula C46H21F3O12 and a molecular weight of 822.66 g/mol. Its IUPAC name is 5-(1,3-dioxo-6-phenyl-2-benzofuran-5-yl)-6-phenyl-2-benzofuran-1,3-dione;5-[1,3-dioxo-6-(trifluoromethyl)-2-benzofuran-5-yl]-6-methyl-2-benzofuran-1,3-dione.
| Compound Name | 5-(1,3-dioxo-6-phenyl-2-benzofuran-5-yl)-6-phenyl-2-benzofuran-1,3-dione;5-[1,3-dioxo-6-(trifluoromethyl)-2-benzofuran-5-yl]-6-methyl-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 158816281 |
| Molecular Formula | C46H21F3O12 |
| Molecular Weight | 822.66 g/mol |
| Exact Mass | 822.10 |
| IUPAC Name | 5-(1,3-dioxo-6-phenyl-2-benzofuran-5-yl)-6-phenyl-2-benzofuran-1,3-dione;5-[1,3-dioxo-6-(trifluoromethyl)-2-benzofuran-5-yl]-6-methyl-2-benzofuran-1,3-dione |
| SMILES | Cc1cc2c(cc1-c1cc3c(cc1C(F)(F)F)C(=O)OC3=O)C(=O)OC2=O.O=C1OC(=O)c2cc(-c3cc4c(cc3-c3ccccc3)C(=O)OC4=O)c(-c3ccccc3)cc21 |
| InChI | InChI=1S/C28H14O6.C18H7F3O6/c29-25-21-11-17(15-7-3-1-4-8-15)19(13-23(21)27(31)33-25)20-14-24-22(26(30)34-28(24)32)12-18(20)16-9-5-2-6-10-16;1-6-2-9-10(15(23)26-14(9)22)3-7(6)8-4-11-12(17(25)27-16(11)24)5-13(8)18(19,20)21/h1-14H;2-5H,1H3 |
| InChIKey | IVHQYOQNMFWKPW-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.66 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|