C6H11F2NO2 — CID 15221399
4-fluoro-2-(fluoromethyl)piperidine-3,5-diol (PubChem CID 15221399) has the molecular formula C6H11F2NO2 and a molecular weight of 167.15 g/mol. Its IUPAC name is 4-fluoro-2-(fluoromethyl)piperidine-3,5-diol.
| Compound Name | 4-fluoro-2-(fluoromethyl)piperidine-3,5-diol |
|---|---|
| PubChem CID | 15221399 |
| Molecular Formula | C6H11F2NO2 |
| Molecular Weight | 167.15 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 4-fluoro-2-(fluoromethyl)piperidine-3,5-diol |
| SMILES | OC1CNC(CF)C(O)C1F |
| InChI | InChI=1S/C6H11F2NO2/c7-1-3-6(11)5(8)4(10)2-9-3/h3-6,9-11H,1-2H2 |
| InChIKey | YPRAVXCCVSVBTO-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.15 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |