C25H40N2O2 — CID 15224701
(8R,9S,13S,14S,17S)-N-[3-(dimethylamino)propyl]-3-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine oxide (PubChem CID 15224701) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-N-[3-(dimethylamino)propyl]-3-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine oxide.
| Compound Name | (8R,9S,13S,14S,17S)-N-[3-(dimethylamino)propyl]-3-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine oxide |
|---|---|
| PubChem CID | 15224701 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | (8R,9S,13S,14S,17S)-N-[3-(dimethylamino)propyl]-3-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-amine oxide |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@H]2[N+](C)([O-])CCCN(C)C |
| InChI | InChI=1S/C25H40N2O2/c1-25-14-13-21-20-10-8-19(29-5)17-18(20)7-9-22(21)23(25)11-12-24(25)27(4,28)16-6-15-26(2)3/h8,10,17,21-24H,6-7,9,11-16H2,1-5H3/t21-,22-,23+,24+,25+,27?/m1/s1 |
| InChIKey | PLZWTPXTJUGURK-WOAZLJTNSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|