C32H30N2O5 — CID 15230316
methyl 5-(4-aminophenoxy)-2-(2,2-diphenylacetyl)-6-methoxy-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 15230316) has the molecular formula C32H30N2O5 and a molecular weight of 522.60 g/mol. Its IUPAC name is methyl 5-(4-aminophenoxy)-2-(2,2-diphenylacetyl)-6-methoxy-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | methyl 5-(4-aminophenoxy)-2-(2,2-diphenylacetyl)-6-methoxy-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 15230316 |
| Molecular Formula | C32H30N2O5 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | methyl 5-(4-aminophenoxy)-2-(2,2-diphenylacetyl)-6-methoxy-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | COC(=O)C1Cc2c(ccc(OC)c2Oc2ccc(N)cc2)CN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H30N2O5/c1-37-28-18-13-23-20-34(31(35)29(21-9-5-3-6-10-21)22-11-7-4-8-12-22)27(32(36)38-2)19-26(23)30(28)39-25-16-14-24(33)15-17-25/h3-18,27,29H,19-20,33H2,1-2H3 |
| InChIKey | FTKUXUVNESZDSL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|