C21H29NO3S — CID 15232552
4,4-dimethyl-1-(4-methylphenyl)sulfonyl-3-non-1-ynylazetidin-2-one (PubChem CID 15232552) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is 4,4-dimethyl-1-(4-methylphenyl)sulfonyl-3-non-1-ynylazetidin-2-one.
| Compound Name | 4,4-dimethyl-1-(4-methylphenyl)sulfonyl-3-non-1-ynylazetidin-2-one |
|---|---|
| PubChem CID | 15232552 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 4,4-dimethyl-1-(4-methylphenyl)sulfonyl-3-non-1-ynylazetidin-2-one |
| SMILES | CCCCCCCC#CC1C(=O)N(S(=O)(=O)c2ccc(C)cc2)C1(C)C |
| InChI | InChI=1S/C21H29NO3S/c1-5-6-7-8-9-10-11-12-19-20(23)22(21(19,3)4)26(24,25)18-15-13-17(2)14-16-18/h13-16,19H,5-10H2,1-4H3 |
| InChIKey | SWDQDUXBIPPXRJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|