C14H22N2O5 — CID 15235395
methyl 2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-5,6-dihydro-2H-azepin-1-yl]acetate (PubChem CID 15235395) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is methyl 2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-5,6-dihydro-2H-azepin-1-yl]acetate.
| Compound Name | methyl 2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-5,6-dihydro-2H-azepin-1-yl]acetate |
|---|---|
| PubChem CID | 15235395 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | methyl 2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-5,6-dihydro-2H-azepin-1-yl]acetate |
| SMILES | COC(=O)CN1CC=CCC(NC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C14H22N2O5/c1-14(2,3)21-13(19)15-10-7-5-6-8-16(12(10)18)9-11(17)20-4/h5-6,10H,7-9H2,1-4H3,(H,15,19) |
| InChIKey | RVNNLVXBSWSFJA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|