C16H26N2O5 — CID 11450214
methyl (2S,5E,9S)-9-[(2-methylpropan-2-yl)oxycarbonylamino]-10-oxo-2,3,4,7,8,9-hexahydro-1H-azecine-2-carboxylate (PubChem CID 11450214) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is methyl (2S,5E,9S)-9-[(2-methylpropan-2-yl)oxycarbonylamino]-10-oxo-2,3,4,7,8,9-hexahydro-1H-azecine-2-carboxylate.
| Compound Name | methyl (2S,5E,9S)-9-[(2-methylpropan-2-yl)oxycarbonylamino]-10-oxo-2,3,4,7,8,9-hexahydro-1H-azecine-2-carboxylate |
|---|---|
| PubChem CID | 11450214 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | methyl (2S,5E,9S)-9-[(2-methylpropan-2-yl)oxycarbonylamino]-10-oxo-2,3,4,7,8,9-hexahydro-1H-azecine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC/C=C/CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C16H26N2O5/c1-16(2,3)23-15(21)18-11-9-7-5-6-8-10-12(14(20)22-4)17-13(11)19/h5-6,11-12H,7-10H2,1-4H3,(H,17,19)(H,18,21)/b6-5+/t11-,12-/m0/s1 |
| InChIKey | YVXOLSJHPNEHOO-WTIVYXKASA-N |
| XLogP | 1.67 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|