C20H36N2O5 — CID 162414318
methyl 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-11-enoyl]amino]acetate (PubChem CID 162414318) has the molecular formula C20H36N2O5 and a molecular weight of 384.52 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-11-enoyl]amino]acetate.
| Compound Name | methyl 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-11-enoyl]amino]acetate |
|---|---|
| PubChem CID | 162414318 |
| Molecular Formula | C20H36N2O5 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | methyl 2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]dodec-11-enoyl]amino]acetate |
| SMILES | C=CCCCCCCCC[C@@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)OC |
| InChI | InChI=1S/C20H36N2O5/c1-6-7-8-9-10-11-12-13-14-16(18(24)21-15-17(23)26-5)22-19(25)27-20(2,3)4/h6,16H,1,7-15H2,2-5H3,(H,21,24)(H,22,25)/t16-/m1/s1 |
| InChIKey | DCKZHMLZAIEPRN-MRXNPFEDSA-N |
| XLogP | 3.48 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|