C26H19ClN2O2 — CID 15237488
1-chloro-4-[[4-[(1Z,3Z)-2,3-diisocyano-4-(4-methoxyphenyl)buta-1,3-dienyl]phenoxy]methyl]benzene (PubChem CID 15237488) has the molecular formula C26H19ClN2O2 and a molecular weight of 426.90 g/mol. Its IUPAC name is 1-chloro-4-[[4-[(1Z,3Z)-2,3-diisocyano-4-(4-methoxyphenyl)buta-1,3-dienyl]phenoxy]methyl]benzene.
| Compound Name | 1-chloro-4-[[4-[(1Z,3Z)-2,3-diisocyano-4-(4-methoxyphenyl)buta-1,3-dienyl]phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 15237488 |
| Molecular Formula | C26H19ClN2O2 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 1-chloro-4-[[4-[(1Z,3Z)-2,3-diisocyano-4-(4-methoxyphenyl)buta-1,3-dienyl]phenoxy]methyl]benzene |
| SMILES | [C-]#[N+]C(=C\c1ccc(OC)cc1)/C(=C/c1ccc(OCc2ccc(Cl)cc2)cc1)[N+]#[C-] |
| InChI | InChI=1S/C26H19ClN2O2/c1-28-25(16-19-6-12-23(30-3)13-7-19)26(29-2)17-20-8-14-24(15-9-20)31-18-21-4-10-22(27)11-5-21/h4-17H,18H2,3H3/b25-16-,26-17- |
| InChIKey | BLNIRDRFGAIBCN-XPKSCPAASA-N |
| XLogP | 7.15 |
| TPSA | 27.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|