About 4-Fluorophenyl isothiocyanate
4-Fluorophenyl isothiocyanate (PubChem CID 15241) has the molecular formula C7H4FNS
and a molecular weight of 153.18 g/mol. Its IUPAC name is 1-fluoro-4-isothiocyanatobenzene.
Molecular Properties
| Compound Name | 4-Fluorophenyl isothiocyanate |
| PubChem CID | 15241 |
| Molecular Formula | C7H4FNS |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.00 |
| IUPAC Name | 1-fluoro-4-isothiocyanatobenzene |
| SMILES | C1=CC(=CC=C1N=C=S)F |
| InChI | InChI=1S/C7H4FNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| InChIKey | NFIUJHJMCQQYDL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 146 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-Fluorophenyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Fluorophenyl isothiocyanate?
The IUPAC name of 4-Fluorophenyl isothiocyanate (CID 15241) is 1-fluoro-4-isothiocyanatobenzene.
What is the SMILES notation for 4-Fluorophenyl isothiocyanate?
The canonical SMILES for 4-Fluorophenyl isothiocyanate is C1=CC(=CC=C1N=C=S)F.
What is the InChIKey of 4-Fluorophenyl isothiocyanate?
The InChIKey is NFIUJHJMCQQYDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H.
What are the key properties of 4-Fluorophenyl isothiocyanate?
4-Fluorophenyl isothiocyanate has a molecular weight of 153.18 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Fluorophenyl isothiocyanate is sourced from PubChem (CID 15241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).