About 3-fluoroaniline
3-fluoroaniline (PubChem CID 9742) has the molecular formula C6H6FN
and a molecular weight of 111.12 g/mol. Its IUPAC name is 3-fluoroaniline.
Molecular Properties
| Compound Name | 3-fluoroaniline |
| PubChem CID | 9742 |
| Molecular Formula | C6H6FN |
| Molecular Weight | 111.12 g/mol |
| Exact Mass | 111.05 |
| IUPAC Name | 3-fluoroaniline |
| SMILES | Nc1cccc(F)c1 |
| InChI | InChI=1S/C6H6FN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2 |
| InChIKey | QZVQQUVWFIZUBQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.12 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoroaniline?
The IUPAC name of 3-fluoroaniline (CID 9742) is 3-fluoroaniline.
What is the SMILES notation for 3-fluoroaniline?
The canonical SMILES for 3-fluoroaniline is Nc1cccc(F)c1.
What is the InChIKey of 3-fluoroaniline?
The InChIKey is QZVQQUVWFIZUBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2.
What are the key properties of 3-fluoroaniline?
3-fluoroaniline has a molecular weight of 111.12 g/mol, XLogP of 1.41, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoroaniline is sourced from PubChem (CID 9742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).