C7H2F12O2 — CID 15243
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoic acid (PubChem CID 15243) has the molecular formula C7H2F12O2 and a molecular weight of 346.07 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoic acid |
|---|---|
| PubChem CID | 15243 |
| Molecular Formula | C7H2F12O2 |
| Molecular Weight | 346.07 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H2F12O2/c8-1(9)3(10,11)5(14,15)7(18,19)6(16,17)4(12,13)2(20)21/h1H,(H,20,21) |
| InChIKey | JZHDEEOTEUVLHR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.07 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|