C16H19N5 — CID 15246044
2-[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine (PubChem CID 15246044) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine.
| Compound Name | 2-[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 15246044 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[bis(3,5-dimethylpyrazol-1-yl)methyl]pyridine |
| SMILES | Cc1cc(C)n(C(c2ccccn2)n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C16H19N5/c1-11-9-13(3)20(18-11)16(15-7-5-6-8-17-15)21-14(4)10-12(2)19-21/h5-10,16H,1-4H3 |
| InChIKey | IDJYYABUNDTOJT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |