C11H17NO3 — CID 15249737
methyl 3-[(3R,8S)-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-3-yl]propanoate (PubChem CID 15249737) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl 3-[(3R,8S)-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-3-yl]propanoate.
| Compound Name | methyl 3-[(3R,8S)-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-3-yl]propanoate |
|---|---|
| PubChem CID | 15249737 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | methyl 3-[(3R,8S)-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-3-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CC[C@H]2CCC(=O)N21 |
| InChI | InChI=1S/C11H17NO3/c1-15-11(14)7-5-9-3-2-8-4-6-10(13)12(8)9/h8-9H,2-7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | IJBGQPDDHHKMEM-DTWKUNHWSA-N |
| XLogP | 1.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |