C12H21NO3 — CID 540193
5-(2,2-dimethoxypropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 540193) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 5-(2,2-dimethoxypropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | 5-(2,2-dimethoxypropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 540193 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5-(2,2-dimethoxypropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | COC(C)(CC1CCC2CCC(=O)N21)OC |
| InChI | InChI=1S/C12H21NO3/c1-12(15-2,16-3)8-10-5-4-9-6-7-11(14)13(9)10/h9-10H,4-8H2,1-3H3 |
| InChIKey | BKVIDBDCHWSWNW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|